CAS 1291487-19-8

1,1-Dimethylethyl 4-[2-(4-bromophenyl)-2-oxoethyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-(4-bromophenyl)-2-oxoethyl]-1-piperazinecarboxylate, with the CAS number 1291487-19-8, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a carboxylate group, and a bromophenyl moiety. This compound typically exhibits properties associated with both piperazine derivatives and ester functionalities, which may influence its solubility, reactivity, and biological activity. The presence of the bromine atom in the phenyl group can enhance lipophilicity and may contribute to specific interactions in biological systems. Additionally, the dimethyl substituents on the ethyl group can affect steric hindrance and overall molecular conformation. Such compounds are often studied for their potential pharmacological applications, including their role as intermediates in drug synthesis or as active pharmaceutical ingredients. Understanding the characteristics of this compound requires consideration of its molecular interactions, stability under various conditions, and potential applications in medicinal chemistry.

Formula: C₁₇H₂₃BrN₂O₃

InChI: InChI=1S/C17H23BrN2O3/c1-17(2,3)23-16(22)20-10-8-19(9-11-20)12-15(21)13-4-6-14(18)7-5-13/h4-7H,8-12H2,1-3H3

InChI key: InChIKey=ARWWJZJCXZYSSE-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCN(CC(=O)C2=CC=C(Br)C=C2)CC1

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[2-(4-bromophenyl)-2-oxoethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[2-(4-bromophenyl)-2-oxoethyl]-1-piperazinecarboxylate

1-BOC-4-(2-(4-bromophenyl)-2-oxoethyl)piperazine

CAS: 1291487-19-8

Formula: C₁₇H₂₃BrN₂O₃

Molecular weight: 383.2801

Ref: IN-DA000YWU