CAS 1291487-21-2
:1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-butylcarbamate
Description:
1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-butylcarbamate, identified by its CAS number 1291487-21-2, is a chemical compound that belongs to the class of carbamates. This substance features a tert-butyl group, which contributes to its steric bulk, and a pyridine ring substituted with a bromine atom, enhancing its reactivity and potential biological activity. The presence of the butyl group indicates that it may exhibit hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The bromine substitution on the pyridine ring can also affect the compound's electronic properties, potentially making it a candidate for various applications in medicinal chemistry or agrochemicals. Additionally, the carbamate functional group suggests that it may undergo hydrolysis, which is relevant for its stability and degradation in environmental contexts. Overall, the unique structural features of this compound may contribute to its specific chemical behavior and potential applications in various fields.
Formula:C14H21BrN2O2
InChI:InChI=1S/C14H21BrN2O2/c1-5-6-9-17(13(18)19-14(2,3)4)12-8-7-11(15)10-16-12/h7-8,10H,5-6,9H2,1-4H3
InChI key:InChIKey=JFYHNENQXVHJSF-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)(CCCC)C1=CC=C(Br)C=N1
Synonyms:- 1,1-Dimethylethyl N-(5-bromo-2-pyridinyl)-N-butylcarbamate
- Carbamic acid, N-(5-bromo-2-pyridinyl)-N-butyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
