CAS 1291487-22-3
:5-Bromo-2-chloro-4-ethylthiazole
Description:
5-Bromo-2-chloro-4-ethylthiazole is a heterocyclic organic compound characterized by the presence of both bromine and chlorine substituents on a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure contributes to its potential reactivity, making it useful in various chemical syntheses and applications, particularly in the field of pharmaceuticals and agrochemicals. The presence of halogen atoms can enhance its biological activity and influence its interaction with biological targets. Additionally, thiazole derivatives are known for their diverse pharmacological properties, including antimicrobial and antifungal activities. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-2-chloro-4-ethylthiazole is a valuable compound in synthetic chemistry, with potential applications in drug development and material science.
Formula:C5H5BrClNS
InChI:InChI=1S/C5H5BrClNS/c1-2-3-4(6)9-5(7)8-3/h2H2,1H3
InChI key:InChIKey=NGHSYJZHLYPHNX-UHFFFAOYSA-N
SMILES:C(C)C1=C(Br)SC(Cl)=N1
Synonyms:- Thiazole, 5-bromo-2-chloro-4-ethyl-
- 5-Bromo-2-chloro-4-ethylthiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
