CAS 1291487-25-6

1,5-Dibromo-2,3-difluoro-4-methoxybenzene

Description:

1,5-Dibromo-2,3-difluoro-4-methoxybenzene is an aromatic compound characterized by the presence of bromine and fluorine substituents on a methoxybenzene ring. The structure features two bromine atoms located at the 1 and 5 positions, and two fluorine atoms at the 2 and 3 positions, along with a methoxy group (-OCH3) at the 4 position. This compound is likely to exhibit significant polarity due to the electronegative halogen atoms, which can influence its reactivity and solubility in various solvents. The presence of multiple halogens may also enhance its potential as a precursor in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the methoxy group can serve as a directing group in electrophilic aromatic substitution reactions. The compound's unique combination of substituents may impart specific biological or chemical properties, making it of interest in fields such as medicinal chemistry or materials science. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₇H₄Br₂F₂O

InChI: InChI=1S/C7H4Br2F2O/c1-12-7-4(9)2-3(8)5(10)6(7)11/h2H,1H3

InChI key: InChIKey=DFVKWLSFGGVRTM-UHFFFAOYSA-N

SMILES: O(C)C1=C(F)C(F)=C(Br)C=C1Br

Synonyms:

• 1,5-Dibromo-2,3-difluoro-4-methoxybenzene
• Benzene, 1,5-dibromo-2,3-difluoro-4-methoxy-

4,6-Dibromo-2,3-difluoroanisole

CAS: 1291487-25-6

Formula: C₇H₄Br₂F₂O

Molecular weight: 301.9109

Ref: IN-DA000YWO