CymitQuimica logo

CAS 1291493-04-3

:

4-[(Tetrahydro-2-furanyl)methoxy]-6-benzofurancarboxylic acid

Description:
4-[(Tetrahydro-2-furanyl)methoxy]-6-benzofurancarboxylic acid, identified by its CAS number 1291493-04-3, is a chemical compound characterized by its complex structure that includes a benzofuran moiety and a tetrahydro-2-furanyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the methoxy group can enhance its lipophilicity, potentially affecting its biological activity and interaction with other molecules. Such compounds are often studied for their potential pharmacological properties, including anti-inflammatory or analgesic effects, due to their structural similarities to known bioactive molecules. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential applications in medicinal chemistry and related fields.
Formula:C14H14O5
InChI:InChI=1S/C14H14O5/c15-14(16)9-6-12-11(3-5-18-12)13(7-9)19-8-10-2-1-4-17-10/h3,5-7,10H,1-2,4,8H2,(H,15,16)
InChI key:InChIKey=BKWVSMZDDKEWSB-UHFFFAOYSA-N
SMILES:O(CC1CCCO1)C2=C3C(=CC(C(O)=O)=C2)OC=C3
Synonyms:
  • 6-Benzofurancarboxylic acid, 4-[(tetrahydro-2-furanyl)methoxy]-
  • 4-[(Tetrahydro-2-furanyl)methoxy]-6-benzofurancarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.