CAS 129179-31-3

2-(2-Methyl-1-propen-1-yl)-3-nitroimidazo[1,2-a]pyridine

Description:

2-(2-Methyl-1-propen-1-yl)-3-nitroimidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a nitro group, and a propenyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the nitro group suggests that it may participate in various chemical reactions, including reduction and nucleophilic substitution. Additionally, the propenyl group can influence the compound's reactivity and steric properties. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 2-(2-Methyl-1-propen-1-yl)-3-nitroimidazo[1,2-a]pyridine represents a unique compound with potential applications in research and industry.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-8(2)7-9-11(14(15)16)13-6-4-3-5-10(13)12-9/h3-7H,1-2H3

InChI key: InChIKey=JZBANANRAZTJLA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N2C(=NC1C=C(C)C)C=CC=C2

Synonyms:

• 2-(2-Methylprop-1-enyl)-3-nitroimidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 2-(2-methyl-1-propen-1-yl)-3-nitro-
• Imidazo[1,2-a]pyridine, 2-(2-methyl-1-propenyl)-3-nitro-
• 2-(2-Methyl-1-propen-1-yl)-3-nitroimidazo[1,2-a]pyridine

Imidazo[1,2-a]pyridine, 2-(2-methyl-1-propen-1-yl)-3-nitro-

CAS: 129179-31-3

Formula: C₁₁H₁₁N₃O₂

Molecular weight: 217.2239

Ref: IN-DA000YXB