CAS 129188-99-4: 4,4′-(3,3,5-Trimethylcyclohexylidene)bis[phenol]
Description:4,4′-(3,3,5-Trimethylcyclohexylidene)bis[phenol], with CAS number 129188-99-4, is an organic compound characterized by its bisphenolic structure, which features two phenolic groups linked by a cyclohexylidene moiety. This compound exhibits significant thermal stability and is often utilized in the production of high-performance polymers and resins due to its excellent mechanical properties and resistance to heat and chemicals. The presence of the trimethyl groups on the cyclohexylidene enhances its steric hindrance, contributing to its stability and potentially influencing its solubility and reactivity. Additionally, the compound may exhibit antioxidant properties, making it useful in various applications, including as a stabilizer in plastics and coatings. Its molecular structure allows for potential applications in the field of materials science, particularly in the development of advanced composites and thermosetting materials. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C21H26O2
InChI:InChI=1S/C21H26O2/c1-15-12-20(2,3)14-21(13-15,16-4-8-18(22)9-5-16)17-6-10-19(23)11-7-17/h4-11,15,22-23H,12-14H2,1-3H3
InChI key:InChIKey=UMPGNGRIGSEMTC-UHFFFAOYSA-N
SMILES:OC1=CC=C(C=C1)C2(C3=CC=C(O)C=C3)CC(C)CC(C)(C)C2
- Synonyms:
- 1,1-Bis(4-Hydroxyphenyl)Propanebis(2-Hydroxypropyl)Ether
- 1,1-Bis(4-hydroxyphenyl)-3,3-dimethyl-5-methyl-cyclohexane
- 3,3,5-Trimethyl-1,1-bis(4-hydroxyphenyl)cyclohexane
- 4,4'-(3,3,5-Trimethylcyclohexane-1,1-Diyl)Diphenol
- 4,4′-(3,3,5-Trimethyl-1,1-cyclohexandiyl)diphenol
- 4,4′-(3,3,5-Trimethylcyclohexylidene)bis[phenol]
- 4,4′-(3,3,5-Trimethylcyclohexylidene)diphenol
- Bis P-HTG
- Bisp-Tmc
- Bisphenol TMC
- See more synonyms
- Bptmc
- Phenol, 4,4′-(3,3,5-trimethylcyclohexylidene)bis-
- 1,1-Bis(4-hydroxyphenyl)-3,3,5-trimethylcyclohexane