CAS 129189-58-8
:4-Tetradecen-1-ol
Description:
4-Tetradecen-1-ol, with the CAS number 129189-58-8, is a long-chain unsaturated alcohol characterized by a 14-carbon backbone and a double bond located at the fourth carbon from the terminal end. This compound is part of the fatty alcohol family and exhibits both hydrophobic and hydrophilic properties due to its long hydrocarbon chain and hydroxyl (-OH) functional group. It is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents while having limited solubility in water. The presence of the double bond contributes to its reactivity, allowing it to participate in various chemical reactions, such as oxidation and polymerization. 4-Tetradecen-1-ol is used in the synthesis of surfactants, emulsifiers, and other chemical intermediates, making it valuable in industrial applications. Additionally, its structure may influence its biological activity, potentially impacting its use in pharmaceuticals and cosmetics. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H28O
InChI:InChI=1S/C14H28O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h10-11,15H,2-9,12-14H2,1H3
InChI key:InChIKey=NFLOGWCACVSGQN-UHFFFAOYSA-N
SMILES:C(CCCCCCC)CC=CCCCO
Synonyms:- 4-Tetradecen-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
