CAS 129201-92-9
:METHYL 5,6-DIHYDRO-4H-PYRAN-2-CARBOXYLATE
Description:
Methyl 5,6-dihydro-4H-pyran-2-carboxylate is an organic compound characterized by its pyran ring structure, which features a five-membered ring containing one oxygen atom. This compound is classified as an ester due to the presence of a carboxylate group (-COO-) attached to a methyl group. It typically appears as a colorless to pale yellow liquid with a pleasant odor. The compound is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water. Its chemical properties include reactivity towards nucleophiles, making it useful in various synthetic applications, particularly in the field of organic chemistry for the synthesis of more complex molecules. Methyl 5,6-dihydro-4H-pyran-2-carboxylate may also exhibit biological activity, which can be of interest in pharmaceutical research. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H10O3
InChI:InChI=1/C7H10O3/c1-9-7(8)6-4-2-3-5-10-6/h4H,2-3,5H2,1H3
SMILES:COC(=O)C1=CCCCO1
Synonyms:- 2H-Pyran-6-carboxylicacid,3,4-dihydro-,methylester(9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
