CAS 129203-60-7: iberiotoxin from buthus tamulus
Description:Iberiotoxin, derived from the venom of the Indian red scorpion (Buthus tamulus), is a potent neurotoxin known for its selective inhibition of certain potassium channels, particularly the voltage-gated potassium channels (Kv) in excitable tissues. This characteristic makes it a valuable tool in neuropharmacology for studying ion channel function and the physiological roles of potassium channels in various cellular processes. Iberiotoxin exhibits a high affinity for the Kv1.3 channel, which is implicated in immune responses and neuronal excitability. The toxin's structure is characterized by a polypeptide chain that folds into a specific three-dimensional conformation, allowing it to interact effectively with its target channels. Its mechanism of action involves binding to the channel and preventing potassium ion flow, which can lead to prolonged depolarization of neurons and muscle cells. Due to its potent effects, iberiotoxin is also of interest in research related to pain, inflammation, and potential therapeutic applications, although its use is primarily confined to laboratory settings due to its toxicity.
Formula:C179H274N50O55S7
InChI:InChI=1/C179H274N50O55S7/c1-87(2)65-111-155(261)208-112(66-93-33-15-13-16-34-93)146(252)195-77-133(239)225-139(88(3)4)172(278)213-117(71-136(244)245)158(264)199-100(44-31-62-190-178(186)187)144(250)193-75-131(237)198-102(40-22-27-58-181)148(254)219-124(167(273)205-109(56-64-285-12)145(251)194-76-132(238)197-101(39-21-26-57-180)147(253)200-105(43-25-30-61-184)151(257)220-123-81-286-288-83-125(221-152(258)106(203-166(123)272)45-32-63-191-179(188)189)169(275)210-113(68-95-46-48-97(234)49-47-95)156(262)206-110(177(283)284)50-53-129(185)235)82-287-291-86-128(168(274)202-104(42-24-29-60-183)150(256)212-116(70-135(242)243)159(265)207-111)224-175(281)142(91(9)10)228-164(270)121(79-231)216-157(263)115(69-96-74-192-99-38-20-19-37-98(96)99)211-170(276)126-84-289-290-85-127(171(277)217-122(80-232)165(271)227-141(90(7)8)174(280)218-120(78-230)163(269)201-103(41-23-28-59-182)149(255)204-108(154(260)222-126)52-55-134(240)241)223-160(266)118(72-137(246)247)214-173(279)140(89(5)6)226-162(268)119(73-138(248)249)215-176(282)143(92(11)233)229-161(267)114(67-94-35-17-14-18-36-94)209-153(259)107-51-54-130(236)196-107/h13-20,33-38,46-49,74,87-92,100-128,139-143,192,230-234H,21-32,39-45,50-73,75-86,180-184H2,1-12H3,(H2,185,235)(H,193,250)(H,194,251)(H,195,252)(H,196,236)(H,197,238)(H,198,237)(H,199,264)(H,200,253)(H,201,269)(H,202,274)(H,203,272)(H,204,255)(H,205,273)(H,206,262)(H,207,265)(H,208,261)(H,209,259)(H,210,275)(H,211,276)(H,212,256)(H,213,278)(H,214,279)(H,215,282)(H,216,263)(H,217,277)(H,218,280)(H,219,254)(H,220,257)(H,221,258)(H,222,260)(H,223,266)(H,224,281)(H,225,239)(H,226,268)(H,227,271)(H,228,270)(H,229,267)(H,240,241)(H,242,243)(H,244,245)(H,246,247)(H,248,249)(H,283,284)(H4,186,187,190)(H4,188,189,191)
- Synonyms:
- Iberiotoxin, Buthus tamulus
- Pyr-Phe-Thr-Asp-Val-Asp-Cys-Ser-Val-Ser-Lys-Glu-Cys-Trp-Ser-Val-Cys-Lys-Asp-Leu-Phe-Gly-Val-Asp-Arg-Gly-Lys-Cys-Met-Gly-Lys-Lys-Cys-Arg-Cys-Tyr-Gln-OH (Disulfide bonds between Cys7 and Cys28/Cys13 and Cys33/ Cys17 and Cys35)
- Iberiotoxin