CAS 129212-92-6
:taxifolin-3-glucopyranoside
Description:
Taxifolin-3-glucopyranoside, with the CAS number 129212-92-6, is a flavonoid glycoside derived from taxifolin, a naturally occurring flavonoid known for its antioxidant properties. This compound features a glucopyranoside moiety, which is a glucose molecule linked to the taxifolin structure, enhancing its solubility and bioavailability. Taxifolin itself is recognized for its potential health benefits, including anti-inflammatory, anti-cancer, and neuroprotective effects. The glycosylation at the 3-position of taxifolin may influence its biological activity and stability. Taxifolin-3-glucopyranoside is typically found in various plant sources, contributing to the plant's defense mechanisms and overall health benefits. Its presence in dietary sources suggests potential applications in nutraceuticals and functional foods. Research into its pharmacological properties is ongoing, with interest in its role in modulating oxidative stress and inflammation in biological systems. Overall, taxifolin-3-glucopyranoside represents a significant compound in the study of natural products and their therapeutic potential.
Formula:C21H22O12
InChI:InChI=1/C21H22O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-27,29-30H,6H2/t13-,15-,17+,18-,19+,20-,21+/m1/s1
Synonyms:- (2S-trans)-2-(3,4-Dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
- Taxifolin-3-O-beta-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-(beta-D-glucopyranosyloxy)-2,3-dihydro-5,7-dihydroxy-, (2S-trans)-
- (2S,3S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-chromen-3-yl beta-D-glucopyranoside
- (2S,3S)-(-)-Glucodistylin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2S,3S)-(-)-Glucodistylin
CAS:European beeches with beech scale have high levels of (2R,3R)-(+)-glucodistylin, (2S,3S)-(-)-glucodistylin, and 3-O-(β-D-xylopyranosyl)taxifolin.Formula:C21H22O12Purity:98%Color and Shape:SolidMolecular weight:466.39(2S,3S)-(-)-Glucodistylin
CAS:Formula:C21H22O12Purity:95%~99%Color and Shape:PowderMolecular weight:466.395(2S,3S)-(-)-Glucodistylin
CAS:(2S,3S)-(-)-Glucodistylin is a naturally occurring stilbene glycoside, classified as a phytochemical. It is sourced specifically from various plant species known for their rich secondary metabolite profiles. The compound is revered for its intricate stereochemistry and biological potential.Formula:C21H22O12Purity:Min. 95%Color and Shape:PowderMolecular weight:466.4 g/mol


