CymitQuimica logo

CAS 129217-90-9

:

1,4-Benzenedicarboxaldehyde, polymer with benzenamine and 2-methylbenzenamine, maleated

Description:
1,4-Benzenedicarboxaldehyde, polymer with benzenamine and 2-methylbenzenamine, maleated, is a complex organic compound characterized by its polymeric structure formed from the reaction of 1,4-benzenedicarboxaldehyde with amines, specifically benzenamine and 2-methylbenzenamine. The maleation process introduces maleic anhydride functionality, enhancing the reactivity and compatibility of the polymer with various substrates. This compound typically exhibits properties such as good thermal stability, chemical resistance, and adhesion characteristics, making it suitable for applications in coatings, adhesives, and composites. The presence of aldehyde groups contributes to its reactivity, allowing for further functionalization or cross-linking. Additionally, the aromatic nature of the polymer backbone imparts rigidity and strength, while the amine components can influence the overall polarity and solubility of the material. Overall, this polymer is valued for its versatility in industrial applications, particularly in formulations requiring enhanced performance characteristics.
Formula:(C8H6O2·C7H9N·C6H7N)x
InChI:InChI=1S/C8H6O2.C7H9N.C6H7N/c9-5-7-1-2-8(6-10)4-3-7;1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6/h1-6H;2-5H,8H2,1H3;1-5H,7H2
InChI key:InChIKey=JHHFPHHMBYMTCR-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=C(C=O)C=C1.CC1=C(N)C=CC=C1.NC1=CC=CC=C1
Synonyms:
  • 1,4-Benzenedicarboxaldehyde, polymer with benzenamine and 2-methylbenzenamine, maleated
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.