CAS 129227-27-6

4-Fluorobenzaldehyde 2-(3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone

Description:

4-Fluorobenzaldehyde 2-(3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone is a chemical compound characterized by its unique structural features, which include a fluorinated benzaldehyde moiety and a hydrazone linkage to a quinoxaline derivative. The presence of the fluorine atom enhances its reactivity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. The hydrazone functional group is known for its ability to form stable complexes and can participate in various chemical reactions, including condensation and oxidation. Additionally, the quinoxaline structure is often associated with pharmacological activities, including antimicrobial and anticancer properties. Overall, 4-Fluorobenzaldehyde 2-(3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone represents a class of compounds that may have significant applications in drug development and chemical synthesis, warranting further investigation into its properties and potential uses.

Formula: C₁₅H₁₁FN₄O

InChI: InChI=1S/C15H11FN4O/c16-11-7-5-10(6-8-11)9-17-20-14-15(21)19-13-4-2-1-3-12(13)18-14/h1-9H,(H,18,20)(H,19,21)

InChI key: InChIKey=JGDHUTAIUPLSIU-UHFFFAOYSA-N

SMILES: N(N=CC1=CC=C(F)C=C1)C2=NC=3C(NC2=O)=CC=CC3

Synonyms:

• 4-Fluorobenzaldehyde 2-(3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone
• Benzaldehyde, 4-fluoro-, (3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone
• Benzaldehyde, 4-fluoro-, 2-(3,4-dihydro-3-oxo-2-quinoxalinyl)hydrazone