
CAS 1292300-96-9
:5-[3-(1,1-Dimethylethyl)-1,2,4-oxadiazol-5-yl]-4-methyl-2-thiazolamine
Description:
5-[3-(1,1-Dimethylethyl)-1,2,4-oxadiazol-5-yl]-4-methyl-2-thiazolamine is a chemical compound characterized by its unique structural features, which include a thiazole and an oxadiazole moiety. The presence of the 1,1-dimethylethyl group contributes to its hydrophobic properties, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological activities due to its functional groups, which can participate in hydrogen bonding and other interactions. The thiazole ring is known for its role in medicinal chemistry, often associated with antimicrobial and anti-inflammatory properties. The oxadiazole component may enhance the compound's stability and reactivity. Overall, the combination of these structural elements suggests that this compound could be of interest in drug development or as a biochemical probe, although specific biological activities would need to be evaluated through experimental studies. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H14N4OS
InChI:InChI=1S/C10H14N4OS/c1-5-6(16-9(11)12-5)7-13-8(14-15-7)10(2,3)4/h1-4H3,(H2,11,12)
InChI key:InChIKey=XTPAXYQTXMQGQJ-UHFFFAOYSA-N
SMILES:CC1=C(SC(N)=N1)C2=NC(C(C)(C)C)=NO2
Synonyms:- 2-Thiazolamine, 5-[3-(1,1-dimethylethyl)-1,2,4-oxadiazol-5-yl]-4-methyl-
- 5-[3-(1,1-Dimethylethyl)-1,2,4-oxadiazol-5-yl]-4-methyl-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.