
CAS 129231-15-8
:1,5-Dimethyl-2-pyrrolidinemethanamine
Description:
1,5-Dimethyl-2-pyrrolidinemethanamine, also known by its CAS number 129231-15-8, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features two methyl groups attached to the first and fifth carbon atoms of the pyrrolidine ring, along with an amine functional group. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the amine group suggests that it may exhibit basic properties and can participate in hydrogen bonding, making it potentially soluble in polar solvents. Its structure indicates potential applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, due to potential toxicity or reactivity. Further research may be necessary to fully understand its properties and applications in various fields.
Formula:C7H16N2
InChI:InChI=1S/C7H16N2/c1-6-3-4-7(5-8)9(6)2/h6-7H,3-5,8H2,1-2H3
InChI key:InChIKey=LEFDNIXZWZEKJG-UHFFFAOYSA-N
SMILES:C(N)C1N(C)C(C)CC1
Synonyms:- (1,5-Dimethylpyrrolidin-2-yl)methanamine
- 1,5-Dimethyl-2-pyrrolidinemethanamine
- 2-Pyrrolidinemethanamine, 1,5-dimethyl-
- 2-(Aminomethyl)-1,5-dimethylpyrrolidine
- 1,5-Dimethyl-2-pyrrolidinemethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.