CAS 1292317-57-7
:1,1-Dimethylethyl 4-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 4-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-piperidinecarboxylate, identified by its CAS number 1292317-57-7, is a synthetic organic compound characterized by its complex molecular structure. It features a piperidine ring, which contributes to its potential biological activity, and a cyano group that may enhance its reactivity and solubility in various solvents. The presence of a boron-containing moiety, specifically a dioxaborolane, suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-containing pharmaceuticals. The tert-butyl group (1,1-dimethylethyl) enhances the compound's lipophilicity, which can influence its pharmacokinetic properties. Overall, this compound's unique structural features may provide avenues for research in drug development, particularly in targeting specific biological pathways or mechanisms. However, detailed studies on its biological activity, stability, and reactivity are necessary to fully understand its potential applications.
Formula:C23H33BN2O5
InChI:InChI=1S/C23H33BN2O5/c1-21(2,3)29-20(27)26-12-10-18(11-13-26)28-19-9-8-17(14-16(19)15-25)24-30-22(4,5)23(6,7)31-24/h8-9,14,18H,10-13H2,1-7H3
InChI key:InChIKey=KEGVFIMDXBKGNA-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1OC2CCN(C(OC(C)(C)C)=O)CC2)B3OC(C)(C)C(C)(C)O3
Synonyms:- 1,1-Dimethylethyl 4-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 4-[2-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.