CAS 129232-37-7
:dicyano-cobalt(III)-tetrakis(N-methyl-4-pyridyl)porphyrin
Description:
Dicyano-cobalt(III)-tetrakis(N-methyl-4-pyridyl)porphyrin is a coordination compound characterized by its cobalt(III) center coordinated to a porphyrin ligand, which is further substituted with four N-methyl-4-pyridyl groups and two cyano groups. This compound exhibits a distinct porphyrin structure, which is known for its ability to facilitate electron transfer and participate in redox reactions. The presence of the cobalt ion imparts unique catalytic properties, making it of interest in various chemical and biological applications, including as a model for metalloenzymes. The N-methyl-4-pyridyl substituents enhance solubility in polar solvents and can influence the electronic properties of the porphyrin system. Additionally, the cyano groups contribute to the overall stability and reactivity of the complex. This compound is often studied in the context of photochemistry, electrochemistry, and as a potential candidate for applications in sensors and molecular electronics. Its unique structural features and electronic properties make it a valuable subject of research in coordination chemistry and materials science.
Formula:C46H36CoN10
InChI:InChI=1/C44H36N8.2CN.Co/c1-49-21-13-29(14-22-49)41-33-5-7-35(45-33)42(30-15-23-50(2)24-16-30)37-9-11-39(47-37)44(32-19-27-52(4)28-20-32)40-12-10-38(48-40)43(36-8-6-34(41)46-36)31-17-25-51(3)26-18-31;2*1-2;/h5-28H,1-4H3;;;/q+2;2*-1;+3
Synonyms:- Cobalt(3+), bis(cyano-C)((4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis(1-methylpyridiniumato))(2-)-N21,N22,N23,N24)-, (OC-6-12)-
- (OC-6-12)-Bis(cyano-C)((4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis(1-methylpyridiniumato))(2-)-N21,N22,N23,N24)cobalt(3+)
- CN2-Co(III)-Tmpyp
- Dicyano-cobalt(III)-tetrakis(N-methyl-4-pyridyl)porphyrin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cobalt(3+), bis(cyano-C)[[4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis[1-methylpyridiniumato]](2-)-N21,N22,N23,N24]-, (OC-6-12)- (9CI)
CAS:Formula:C46H42Con10Molecular weight:793.8259 G/Mol

