
CAS 1292324-45-8
:1,1-Dimethylethyl N-[(3S)-tetrahydro-3-furanyl]carbamate
Description:
1,1-Dimethylethyl N-[(3S)-tetrahydro-3-furanyl]carbamate, with the CAS number 1292324-45-8, is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the tetrahydrofuran moiety indicates that it has a cyclic ether structure, which may enhance its stability and solubility in organic solvents. The stereochemistry of the compound, particularly the (3S) configuration, suggests that it may exhibit specific interactions in biological systems, making it of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound may have applications in pharmaceuticals or agrochemicals, but further studies would be necessary to fully understand its behavior and potential uses.
Formula:C9H17NO3
InChI:InChI=1S/C9H17NO3/c1-9(2,3)13-8(11)10-7-4-5-12-6-7/h7H,4-6H2,1-3H3,(H,10,11)/t7-/m0/s1
InChI key:InChIKey=FXXHXMXRVSVHQK-ZETCQYMHSA-N
SMILES:N(C(OC(C)(C)C)=O)[C@H]1CCOC1
Synonyms:- 1,1-Dimethylethyl N-[(3S)-tetrahydro-3-furanyl]carbamate
- Carbamic acid, N-[(3S)-tetrahydro-3-furanyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.