CymitQuimica logo

CAS 1292369-86-8

:

3-Chloro-4-ethylpyridazine

Description:
3-Chloro-4-ethylpyridazine is a heterocyclic organic compound characterized by a pyridazine ring, which consists of two adjacent nitrogen atoms in a six-membered ring. The presence of a chlorine atom at the 3-position and an ethyl group at the 4-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the ethyl group can affect the compound's lipophilicity and biological activity. As with many halogenated compounds, safety precautions should be taken when handling 3-Chloro-4-ethylpyridazine due to potential toxicity and environmental concerns. Its applications may span across fields such as pharmaceuticals, agrochemicals, and materials science, although specific uses would depend on further research and development.
Formula:C6H7ClN2
InChI:InChI=1S/C6H7ClN2/c1-2-5-3-4-8-9-6(5)7/h3-4H,2H2,1H3
InChI key:InChIKey=JWNYANPTYPOIRZ-UHFFFAOYSA-N
SMILES:C(C)C1=C(Cl)N=NC=C1
Synonyms:
  • 3-Chloro-4-ethylpyridazine
  • Pyridazine, 3-chloro-4-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.