CAS 129238-74-0
:6-fluoroaminopurine
Description:
6-Fluoroaminopurine is a synthetic purine derivative characterized by the presence of a fluorine atom at the 6-position of the purine ring and an amino group at the 2-position. This compound is notable for its structural similarity to adenine, which allows it to interact with nucleic acids and potentially interfere with nucleic acid metabolism. It is often studied for its potential applications in molecular biology and medicinal chemistry, particularly as a nucleoside analog that can affect DNA and RNA synthesis. The presence of the fluorine atom can enhance the compound's stability and alter its biological activity compared to its non-fluorinated counterparts. Additionally, 6-fluoroaminopurine may exhibit antiviral or anticancer properties, making it a subject of interest in drug development. Its solubility, reactivity, and biological interactions are influenced by its functional groups and molecular structure, which are critical for understanding its potential therapeutic applications.
Formula:C5H4FN5
InChI:InChI=1/C5H4FN5/c6-11-5-3-4(8-1-7-3)9-2-10-5/h1-2H,(H2,7,8,9,10,11)
SMILES:c1nc2c([nH]1)ncnc2NF
Synonyms:- 6-Fap
- N-Fluoro-1H-purin-6-amine
- 1H-Purin-6-amine, N-fluoro-
- N-fluoro-7H-purin-6-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
