
CAS 129254-77-9
:4-(3-Bromopropyl)-2-chloro-1-methylbenzene
Description:
4-(3-Bromopropyl)-2-chloro-1-methylbenzene, with the CAS number 129254-77-9, is an organic compound characterized by its aromatic structure, which includes a methyl group and halogen substituents. The presence of a bromopropyl group and a chloro group on the benzene ring contributes to its reactivity and potential applications in organic synthesis. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic aromatic system, which can influence its solubility in organic solvents. The bromine and chlorine atoms introduce electrophilic characteristics, making it a potential candidate for nucleophilic substitution reactions. Additionally, the compound may display biological activity, which could be explored in medicinal chemistry. Safety data sheets would typically indicate that it should be handled with care, as halogenated compounds can pose health risks. Overall, 4-(3-Bromopropyl)-2-chloro-1-methylbenzene is a versatile compound with implications in various chemical research and industrial applications.
Formula:C10H12BrCl
InChI:InChI=1S/C10H12BrCl/c1-8-4-5-9(3-2-6-11)7-10(8)12/h4-5,7H,2-3,6H2,1H3
InChI key:InChIKey=OKLMKURPNKACJM-UHFFFAOYSA-N
SMILES:C(CCBr)C1=CC(Cl)=C(C)C=C1
Synonyms:- 1-(3-Bromopropyl)-3-chloro-4-methylbenzene
- 4-(3-Bromopropyl)-2-chloro-1-methylbenzene
- Benzene, 4-(3-bromopropyl)-2-chloro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.