
CAS 129263-76-9
:(6S)-Tetrahydro-6-nonyl-2H-pyran-2-one
Description:
(6S)-Tetrahydro-6-nonyl-2H-pyran-2-one, with the CAS number 129263-76-9, is a chemical compound characterized by its unique cyclic structure and specific stereochemistry. This substance features a pyran ring, which is a six-membered ring containing one oxygen atom and five carbon atoms, and it is substituted with a nonyl group, contributing to its hydrophobic properties. The presence of the tetrahydro configuration indicates that the compound is fully saturated, which affects its reactivity and stability. This compound is typically colorless to pale yellow in appearance and may possess a characteristic odor, often associated with its use in flavoring and fragrance applications. Its stereochemistry, denoted by the (6S) designation, suggests that it has specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Overall, (6S)-Tetrahydro-6-nonyl-2H-pyran-2-one is of interest in various fields, including organic synthesis and the development of flavoring agents.
Formula:C14H26O2
InChI:InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-10-13-11-9-12-14(15)16-13/h13H,2-12H2,1H3/t13-/m0/s1
InChI key:InChIKey=SKQYTJLYRIFFCO-ZDUSSCGKSA-N
SMILES:C(CCCCCCCC)[C@@H]1OC(=O)CCC1
Synonyms:- (6S)-Tetrahydro-6-nonyl-2H-pyran-2-one
- 2H-Pyran-2-one, tetrahydro-6-nonyl-, (S)-
- 2H-Pyran-2-one, tetrahydro-6-nonyl-, (6S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
