CymitQuimica logo

CAS 129271-99-4

:

N-(2-Acetylphenyl)benzenesulfonamide

Description:
N-(2-Acetylphenyl)benzenesulfonamide, with the CAS number 129271-99-4, is an organic compound characterized by its sulfonamide functional group, which is attached to a benzene ring. This compound features an acetyl group linked to a phenyl ring, contributing to its overall structure and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The sulfonamide group imparts unique chemical properties, including potential antibacterial activity, making it of interest in pharmaceutical applications. Additionally, the presence of the acetyl group can influence the compound's electronic properties and reactivity, potentially affecting its interactions in biological systems. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, N-(2-Acetylphenyl)benzenesulfonamide represents a class of compounds that are significant in medicinal chemistry and material science.
Formula:C14H13NO3S
InChI:InChI=1S/C14H13NO3S/c1-11(16)13-9-5-6-10-14(13)15-19(17,18)12-7-3-2-4-8-12/h2-10,15H,1H3
InChI key:InChIKey=DBDUKXZPNKUGAA-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CC=C1)C2=C(C(C)=O)C=CC=C2
Synonyms:
  • Benzenesulfonamide, N-(2-acetylphenyl)-
  • N-(2-Acetylphenyl)benzenesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.