CymitQuimica logo

CAS 129278-24-6

:

2H-Pyran, tetrahydro-4-methyl-2-(2,2,2-trifluoroethoxy)-, cis-

Description:
2H-Pyran, tetrahydro-4-methyl-2-(2,2,2-trifluoroethoxy)-, cis- (CAS 129278-24-6) is a chemical compound characterized by its pyran ring structure, which is a six-membered heterocyclic compound containing one oxygen atom. This specific compound features a tetrahydro configuration, indicating that it has undergone hydrogenation, resulting in a saturated ring. The presence of a methyl group and a trifluoroethoxy substituent contributes to its unique chemical properties, including potential polarity and reactivity. The trifluoroethoxy group introduces significant electronegativity due to the fluorine atoms, which can influence the compound's solubility and interaction with other substances. The "cis" designation indicates the spatial arrangement of the substituents around the ring, which can affect the compound's stereochemistry and biological activity. Overall, this compound may exhibit interesting properties for applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.
Formula:C8H13F3O2
InChI:InChI=1/C8H13F3O2/c1-6-2-3-12-7(4-6)13-5-8(9,10)11/h6-7H,2-5H2,1H3/t6-,7-/s2
InChI key:InChIKey=KIHRVUONLPVRJI-WZTWBHKBNA-N
SMILES:O(CC(F)(F)F)[C@H]1C[C@@H](C)CCO1
Synonyms:
  • 2H-Pyran, tetrahydro-4-methyl-2-(2,2,2-trifluoroethoxy)-, cis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.