CAS 129282-35-5

3-Methyl-4-nitroso-1,2,5-oxadiazole

Description:

3-Methyl-4-nitroso-1,2,5-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a methyl group and a nitroso group, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, indicating its potential for colorimetric applications. The presence of the nitroso group suggests that it may exhibit reactivity typical of nitroso compounds, such as participating in electrophilic reactions. Additionally, the oxadiazole structure can impart stability and influence the compound's solubility in various solvents. 3-Methyl-4-nitroso-1,2,5-oxadiazole may have applications in organic synthesis, materials science, or as a precursor for other chemical transformations. However, due to the presence of nitrogen oxides, it is essential to handle this compound with care, considering potential toxicity and environmental impact. As with any chemical substance, proper safety protocols should be followed during its use and disposal.

Formula: C₃H₃N₃O₂

InChI: InChI=1S/C3H3N3O2/c1-2-3(4-7)6-8-5-2/h1H3

InChI key: InChIKey=VJLGJRLXTBIPQP-UHFFFAOYSA-N

SMILES: N(=O)C=1C(C)=NON1

Synonyms:

• 1,2,5-Oxadiazole, 3-methyl-4-nitroso-
• 3-Methyl-4-nitroso-1,2,5-oxadiazole
• Furazan, methylnitroso-

1,2,5-Oxadiazole, 3-methyl-4-nitroso-

CAS: 129282-35-5

Formula: C₃H₃N₃O₂

Molecular weight: 113.0748

Ref: IN-DA000Z1L