CAS 129286-37-9
:10-fluorobenzo(j)fluoranthene
Description:
10-Fluorobenzo(j)fluoranthene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which includes a fluorine atom substituent at the 10-position of the benzo(j)fluoranthene framework. This compound is typically recognized for its potential environmental persistence and bioaccumulation, as many PAHs exhibit these properties. The presence of the fluorine atom can influence its chemical reactivity and physical properties, such as solubility and volatility. PAHs, including 10-fluorobenzo(j)fluoranthene, are often studied for their carcinogenic potential and environmental impact, particularly in relation to combustion processes and industrial activities. The compound may also exhibit fluorescence, making it of interest in various analytical applications. Its synthesis and characterization often involve advanced organic chemistry techniques, and it may be utilized in research related to organic electronics or as a model compound in studies of PAH behavior in environmental systems. Safety and handling precautions are essential due to the potential toxicity associated with PAHs.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-14-8-10-15-13(11-14)7-9-17-16-5-1-3-12-4-2-6-18(19(12)16)20(15)17/h1-11H
SMILES:c1cc2cccc3c2c(c1)c1ccc2cc(ccc2c31)F
Synonyms:- Ccris 6418
- Benzo(j)fluoranthene, 10-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
