CymitQuimica logo

CAS 129287-26-9

:

3-(6-CHLORO-3-PYRIDAZINYL)-1H-INDOLE

Description:
3-(6-Chloro-3-pyridazinyl)-1H-indole, identified by its CAS number 129287-26-9, is a chemical compound that features a complex structure combining an indole moiety with a pyridazine ring. The presence of the chloro substituent on the pyridazine enhances its reactivity and may influence its biological activity. This compound is typically characterized by its aromatic properties, which contribute to its stability and potential interactions in various chemical environments. It may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. The indole structure is known for its occurrence in many natural products and its role in biological systems, while the pyridazine ring can impart unique electronic properties. Overall, the combination of these two structural elements suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H8ClN3
InChI:InChI=1/C12H8ClN3/c13-12-6-5-11(15-16-12)9-7-14-10-4-2-1-3-8(9)10/h1-7,14H
SMILES:c1ccc2c(c1)c(c[nH]2)c1ccc(Cl)nn1
Synonyms:
  • 3-(6-Chloropyridazin-3-Yl)-1H-Indole
  • 3-(6-CHLORO-3-PYRIDAZINYL)-1H-INDOLE
  • 3-Chloro-6-(3-indolyl)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.