CAS 129297-21-8
:9-amino-8-fluoro-1,2,3,4-tetrahydro-2,4-methanoacridine
Description:
9-Amino-8-fluoro-1,2,3,4-tetrahydro-2,4-methanoacridine is a chemical compound characterized by its unique bicyclic structure, which includes a fused acridine framework. This compound features an amino group at the 9-position and a fluorine atom at the 8-position, contributing to its potential biological activity. The tetrahydro configuration indicates that the compound contains four saturated carbon atoms, which can influence its reactivity and interaction with biological targets. The presence of the fluorine atom may enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural characteristics suggest potential applications in areas such as neuropharmacology or as a scaffold for drug design. The compound's CAS number, 129297-21-8, allows for easy identification and retrieval of information in chemical databases. Overall, the unique structural features of 9-amino-8-fluoro-1,2,3,4-tetrahydro-2,4-methanoacridine position it as a noteworthy candidate for further research and development in various chemical and biological applications.
Formula:C14H13FN2
InChI:InChI=1/C14H13FN2/c15-10-2-1-3-11-12(10)13(16)9-6-7-4-8(5-7)14(9)17-11/h1-3,7-8H,4-6H2,(H2,16,17)
SMILES:c1cc(c2c(c1)nc1C3CC(C3)Cc1c2N)F
Synonyms:- Sm 10888
- 2,4-Methanoacridin-9-amine, 8-fluoro-1,2,3,4-tetrahydro-, 2-hydroxy-1,2,3-propanetricarboxylate (3:2)
- 8-Fluoro-1,2,3,4-Tetrahydro-2,4-Methanoacridin-9-Amine 2-Hydroxypropane-1,2,3-Tricarboxylate (3:2)
- 8-Fluoro-1,2,3,4-Tetrahydro-2,4-Methanoacridin-9-Amine
- 9-Amino-8-fluoro-1,2,3,4-tetrahydro-2,4-methanoacridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4-Methanoacridin-9-amine, 8-fluoro-1,2,3,4-tetrahydro-, 2-hydroxy-1,2,3-propanetricarboxylate (3:2)
CAS:Formula:C54H55F3N6O14Molecular weight:1069.0415
