
CAS 129303-83-9
:1,4-Dimethyl-1H-1,2,3-triazolo[4,5-c]pyridine
Description:
1,4-Dimethyl-1H-1,2,3-triazolo[4,5-c]pyridine is a heterocyclic compound characterized by its unique triazole and pyridine ring structure. This compound features a triazole ring fused to a pyridine ring, with two methyl groups attached at the 1 and 4 positions of the triazole. It is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of both nitrogen-containing rings contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various properties such as fluorescence or specific reactivity due to the electron-rich nature of the triazole and the aromatic character of the pyridine. Its CAS number, 129303-83-9, allows for easy identification in chemical databases. Overall, 1,4-Dimethyl-1H-1,2,3-triazolo[4,5-c]pyridine is a compound of interest for further research in synthetic and medicinal chemistry due to its structural complexity and potential applications.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c1-5-7-6(3-4-8-5)11(2)10-9-7/h3-4H,1-2H3
InChI key:InChIKey=HOHOMJFVZGOMMC-UHFFFAOYSA-N
SMILES:CC1=C2C(N(C)N=N2)=CC=N1
Synonyms:- 1H-1,2,3-Triazolo[4,5-c]pyridine, 1,4-dimethyl-
- 1,4-Dimethyl-1H-1,2,3-triazolo[4,5-c]pyridine
- 1,4-Dimethyltriazolo[4,5-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.