CAS 1293284-55-5: 5-Methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid

Description:5-Methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid is a chemical compound characterized by its unique structural features, which include a methoxy group and a triazole ring. This compound belongs to the class of benzoic acids, indicating the presence of a carboxylic acid functional group attached to a benzene ring. The methoxy group contributes to its solubility and potential reactivity, while the triazole moiety may impart biological activity, making it of interest in medicinal chemistry. The presence of the triazole ring suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or antifungal agents. Additionally, the compound's molecular structure may influence its physical properties, such as melting point, boiling point, and solubility in various solvents. As with many organic compounds, its behavior in chemical reactions can be influenced by the functional groups present, making it a subject of interest for further research in synthetic and medicinal chemistry. Overall, 5-Methoxy-2-(2H-1,2,3-triazol-2-yl)benzoic acid represents a versatile compound with potential applications in various fields.

Formula:C₁₀H₉N₃O₃

InChI:InChI=1S/C10H9N3O3/c1-16-7-2-3-9(8(6-7)10(14)15)13-11-4-5-12-13/h2-6H,1H3,(H,14,15)

InChI key:InChIKey=OFURCFFCWJMVKQ-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(OC)=CC=C1N2N=CC=N2