
CAS 1293284-62-4
:2-Fluoro-6-pyrimidin-2-yl-benzoic acid methyl ester
Description:
2-Fluoro-6-pyrimidin-2-yl-benzoic acid methyl ester is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety esterified with a methyl group and a pyrimidine ring substituted with a fluorine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. As a methyl ester, it may also be subject to hydrolysis under certain conditions, releasing the corresponding benzoic acid. The presence of the pyrimidine ring suggests potential applications in pharmaceuticals or agrochemicals, as pyrimidine derivatives are often explored for their biological activities. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science.
Formula:C12H9FN2O2
InChI:InChI=1S/C12H9FN2O2/c1-17-12(16)10-8(4-2-5-9(10)13)11-14-6-3-7-15-11/h2-7H,1H3
InChI key:InChIKey=VFWHJJKKMBKSSG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CC=C1F)C=2N=CC=CN2
Synonyms:- Benzoic acid, 2-fluoro-6-(2-pyrimidinyl)-, methyl ester
- 2-Fluoro-6-pyrimidin-2-yl-benzoic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
