CymitQuimica logo

CAS 1293288-25-1

:

4,9-Dihydro-1,4-dioxo-1H-carbazole-8-acetic acid

Description:
4,9-Dihydro-1,4-dioxo-1H-carbazole-8-acetic acid is a chemical compound characterized by its unique structure, which includes a carbazole core fused with a dioxo group and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the dioxo groups suggests that it may participate in redox reactions, while the acetic acid component can engage in hydrogen bonding and influence its acidity. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry and material science. Its CAS number, 1293288-25-1, allows for precise identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, 4,9-Dihydro-1,4-dioxo-1H-carbazole-8-acetic acid represents a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C14H9NO4
InChI:InChI=1S/C14H9NO4/c16-9-4-5-10(17)14-12(9)8-3-1-2-7(6-11(18)19)13(8)15-14/h1-5,15H,6H2,(H,18,19)
InChI key:InChIKey=NAEXJYIJIONZJF-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(NC2C(=O)C=C1)=C(CC(O)=O)C=CC3
Synonyms:
  • 4,9-Dihydro-1,4-dioxo-1H-carbazole-8-acetic acid
  • 1H-Carbazole-8-acetic acid, 4,9-dihydro-1,4-dioxo-
  • (1,4-Dioxo-4,9-dihydro-1H-carbazol-8-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.