CAS 129332-45-2
:methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
Description:
Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate, with the CAS number 129332-45-2, is a chemical compound characterized by its unique thiophene ring structure, which incorporates various functional groups that contribute to its reactivity and properties. This compound features an amino group, a cyano group, and a methylthio group, all of which can influence its chemical behavior, including its potential as a building block in organic synthesis or as an intermediate in pharmaceutical applications. The presence of the carboxylate group suggests that it may exhibit acidic properties, while the methylthio group can enhance its solubility in organic solvents. Additionally, the thiophene ring can provide aromatic stability and may participate in various chemical reactions, such as electrophilic substitutions. Overall, this compound's diverse functional groups and structural characteristics make it a subject of interest in both synthetic organic chemistry and materials science.
Formula:C8H8N2O2S2
InChI:InChI=1/C8H8N2O2S2/c1-12-7(11)6-5(10)4(3-9)8(13-2)14-6/h10H2,1-2H3
SMILES:COC(=O)c1c(c(C#N)c(SC)s1)N
Synonyms:- Methyl 3-Amino-4-Cyano-5-(Methylsulfanyl)Thiophene-2-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8N2O2S2Purity:97%Color and Shape:Powder, CreamMolecular weight:228.28Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
CAS:Formula:C8H8N2O2S2Color and Shape:SolidMolecular weight:228.2913Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
CAS:Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylatePurity:97%Molecular weight:228.29g/mol


