CAS 129350-09-0
:O-geranylconiferyl alcohol
Description:
O-geranylconiferyl alcohol is a phenolic compound that belongs to the class of lignans, which are known for their diverse biological activities and potential health benefits. This compound is characterized by its unique structure, which includes a geranyl group and a coniferyl alcohol moiety, contributing to its potential antioxidant properties. O-geranylconiferyl alcohol is typically found in various plant species, particularly in those with medicinal properties. Its chemical structure allows it to participate in various biochemical pathways, potentially influencing plant defense mechanisms and exhibiting antimicrobial activity. Additionally, compounds like O-geranylconiferyl alcohol are of interest in the field of natural product chemistry and pharmacognosy due to their potential therapeutic applications, including anti-inflammatory and anticancer effects. Research into this compound continues to explore its role in plant biology and its potential benefits in human health, making it a subject of interest in both academic and pharmaceutical research.
Formula:C20H28O3
InChI:InChI=1/C20H28O3/c1-16(2)7-5-8-17(3)12-14-23-19-11-10-18(9-6-13-21)15-20(19)22-4/h6-7,9-12,15,21H,5,8,13-14H2,1-4H3/b9-6+,17-12+
Synonyms:- (E,E)-3-(4-((3,7-Dimethyl-2,6-octadienyl)oxy)-3-methoxyphenyl)-2-propen-1-ol
- 2-Propen-1-ol, 3-(4-((3,7-dimethyl-2,6-octadienyl)oxy)-3-methoxyphenyl)-, (E,E)-
- (2E)-3-(4-{[(2E)-3,7-dimethylocta-2,6-dien-1-yl]oxy}-3-methoxyphenyl)prop-2-en-1-ol
- O-Geranylconiferyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Propen-1-ol, 3-[4-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-3-methoxyphenyl]-, (2E)-
CAS:Formula:C20H28O3Purity:95%Molecular weight:316.4345O-Geranylconiferyl alcohol
CAS:<p>O-Geranylconiferyl alcohol is a natural product of Zanthoxylum, Rutaceae.</p>Formula:C20H28O3Purity:98%Color and Shape:SolidMolecular weight:316.43O-Geranylconiferyl alcohol
CAS:Formula:C20H28O3Purity:95%~99%Color and Shape:PowderMolecular weight:316.441o-Geranylconiferyl alcohol
CAS:<p>o-Geranylconiferyl alcohol is a naturally occurring phenolic compound, which is primarily isolated from various plant sources. This compound is a structural derivative of coniferyl alcohol, featuring an additional geranyl moiety that contributes to its distinct bioactive properties. The mode of action of o-Geranylconiferyl alcohol involves its interaction with specific biological pathways, potentially influencing processes such as enzyme activity modulation and antioxidant mechanisms.</p>Formula:C20H28O3Purity:Min. 95%Molecular weight:316.4 g/mol



