CAS 129365-24-8
:1-Cbz-Piperazine-2-Carboxylic Acid
Description:
1-Cbz-Piperazine-2-Carboxylic Acid, with the CAS number 129365-24-8, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "Cbz" refers to the benzyloxycarbonyl (Cbz) protecting group attached to the nitrogen, which is commonly used in peptide synthesis to protect amines. This compound features a carboxylic acid functional group, contributing to its acidic properties. It is typically utilized in organic synthesis, particularly in the development of pharmaceuticals and biologically active compounds. The presence of both the carboxylic acid and the piperazine structure allows for potential interactions in biological systems, making it a valuable intermediate in medicinal chemistry. Additionally, its solubility and reactivity can be influenced by the pH of the environment, which is an important consideration in its applications. Overall, 1-Cbz-Piperazine-2-Carboxylic Acid serves as a versatile building block in the synthesis of more complex molecules.
Formula:C13H16N2O4
InChI:InChI=1/C13H16N2O4/c16-12(17)11-8-14-6-7-15(11)13(18)19-9-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2,(H,16,17)
SMILES:c1ccc(cc1)COC(=O)N1CCNCC1C(=O)O
Synonyms:- Piperazine-1,2-Dicarboxylic Acid 1-Benzyl Ester
- 1N-Cbz-Piperazine-2-Carboxylic Acid
- 1-[(Benzyloxy)Carbonyl]Piperazine-2-Carboxylic Acid
- 1-(Benzyloxycarbonyl)piperazine-2-carboxylic acid
- 1,2-Piperazinedicarboxylic acid, 1-(phenylmethyl) ester
- 1-phenylmethoxycarbonylpiperazine-2-carboxylic acid
- 1-phenylmethoxycarbonyl-2-piperazinecarboxylic acid
- 1-CBZ-PIPERAZINE-2-CARBOXYLIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
