CAS 129365-30-6
:Phosphinic acid, (3-bromopropyl)methyl-, ethyl ester
Description:
Phosphinic acid, (3-bromopropyl)methyl-, ethyl ester, identified by CAS number 129365-30-6, is an organophosphorus compound characterized by the presence of a phosphinic acid functional group. This compound typically features a phosphorous atom bonded to a methyl group and an ethyl ester moiety, along with a 3-bromopropyl substituent. The presence of the bromine atom introduces notable reactivity, potentially influencing its chemical behavior and interactions. As an ester, it is likely to exhibit moderate solubility in organic solvents, while its phosphinic acid structure may impart some polar characteristics. This compound may be of interest in various applications, including agrochemicals, pharmaceuticals, or as a reagent in organic synthesis. Its reactivity can be attributed to the electrophilic nature of the phosphorus center, making it a candidate for nucleophilic attack in chemical reactions. Safety and handling considerations are essential due to the potential toxicity associated with organophosphorus compounds, necessitating appropriate precautions during use.
Formula:C6H14BrO2P
InChI:InChI=1S/C6H14BrO2P/c1-3-9-10(2,8)6-4-5-7/h3-6H2,1-2H3
InChI key:InChIKey=MPGOHMCQUMHESZ-UHFFFAOYSA-N
SMILES:P(CCCBr)(OCC)(C)=O
Synonyms:- Phosphinic acid, (3-bromopropyl)methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
