CymitQuimica logo

CAS 129365-93-1

:

1,2-Benzenedicarbonitrile, 4,5-diamino-

Description:
1,2-Benzenedicarbonitrile, 4,5-diamino- is an organic compound characterized by the presence of two cyano groups (-C≡N) and two amino groups (-NH2) attached to a benzene ring. This compound features a symmetrical structure, with the cyano groups located at the 1 and 2 positions and the amino groups at the 4 and 5 positions on the aromatic ring. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The compound is of interest in various fields, including materials science and organic synthesis, due to its potential applications in the development of dyes, pharmaceuticals, and polymers. Additionally, the presence of both electron-withdrawing (cyano) and electron-donating (amino) groups can influence its reactivity and interaction with other chemical species, making it a versatile building block in organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-3-5-1-7(11)8(12)2-6(5)4-10/h1-2H,11-12H2
InChI key:PCKAZQYWUDIFQM-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1N)N)C#N)C#N
Synonyms:
  • 4,5-Diaminophthalonitrile
  • 4,5-Diamino-1,2-benzenedicarbonitrile
Found 5 products.