CAS 129368-70-3
:(6-BROMOHEXYLOXY)-TERT-BUTYLDIMETHYL-
Description:
The chemical substance known as (6-BROMOHEXYLOXY)-TERT-BUTYLDIMETHYL- is characterized by its unique molecular structure, which includes a bromine atom attached to a hexyl chain, along with tert-butyldimethyl groups. This compound is likely to exhibit properties typical of alkyl halides, such as moderate polarity and potential reactivity in nucleophilic substitution reactions due to the presence of the bromine atom. The tert-butyl and dimethyl groups contribute to steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the presence of the ether-like hexoxy group may impart some degree of hydrophobic character, affecting its interactions with other chemical species. The compound's specific applications and behavior in chemical reactions would depend on its functional groups and overall molecular architecture, making it of interest in fields such as organic synthesis and materials science. As with any chemical substance, safety data and handling precautions should be observed due to potential hazards associated with its components.
Formula:C12H27BrOSi
InChI:InChI=1/C12H27BrOSi/c1-12(2,3)15(4,5)14-11-9-7-6-8-10-13/h6-11H2,1-5H3
SMILES:CC(C)(C)[Si](C)(C)OCCCCCCBr
Synonyms:- [(6-Bromohexyl)Oxy](Tert-Butyl)Dimethylsilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(6-Bromohexyloxy)-tert-butyldimethylsilane, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H27BrOSiPurity:99%Color and Shape:Clear colorless, LiquidMolecular weight:295.34Silane, [(6-bromohexyl)oxy](1,1-dimethylethyl)dimethyl-
CAS:Formula:C12H27BrOSiPurity:96%Color and Shape:LiquidMolecular weight:295.3317((6-Bromohexyl)oxy)(tert-butyl)dimethylsilane
CAS:((6-Bromohexyl)oxy)(tert-butyl)dimethylsilanePurity:95%Molecular weight:295.33g/mol



