
CAS 129371-31-9
:1,3-Benzenediol, 5-(hydroxymethyl)-, homopolymer
Description:
1,3-Benzenediol, 5-(hydroxymethyl)-, homopolymer, also known as a polymer derived from the monomer 5-(hydroxymethyl)-1,3-benzenediol, exhibits several notable characteristics. This substance is a synthetic polymer that typically features a structure comprising repeating units of the benzenediol monomer, which contributes to its stability and potential for various applications. The presence of hydroxymethyl groups enhances its solubility in water and may provide sites for further chemical modification, making it versatile in formulations. The polymer is generally characterized by its thermal stability, resistance to degradation, and potential biocompatibility, which can be advantageous in biomedical applications. Additionally, it may exhibit antioxidant properties due to the presence of phenolic groups, which can scavenge free radicals. Its applications can range from use in coatings and adhesives to potential roles in drug delivery systems and other advanced materials. However, specific properties such as molecular weight, viscosity, and mechanical strength can vary based on the polymerization conditions and processing methods employed.
Formula:(C7H8O3)x
InChI:InChI=1S/C7H8O3/c8-4-5-1-6(9)3-7(10)2-5/h1-3,8-10H,4H2
InChI key:InChIKey=NGYYFWGABVVEPL-UHFFFAOYSA-N
SMILES:C(O)C1=CC(O)=CC(O)=C1
Synonyms:- Poly(3,5-dihydroxybenzyl alcohol)
- 3,5-Dihydroxybenzyl alcohol polymer
- 3,5-Dihydroxybenzyl alcohol homopolymer
- 1,3-Benzenediol, 5-(hydroxymethyl)-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
