CAS 129378-56-9

2-[(1,1-Dimethylethyl)dimethylsilyl]-N,N,5-trimethyl-1H-imidazole-1-sulfonamide

Description:

2-[(1,1-Dimethylethyl)dimethylsilyl]-N,N,5-trimethyl-1H-imidazole-1-sulfonamide is a chemical compound characterized by its complex structure, which includes an imidazole ring, a sulfonamide group, and a silyl substituent. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. The imidazole moiety contributes to its potential biological activity, as imidazoles are often found in pharmaceuticals and agrochemicals. This compound is likely to exhibit properties such as moderate polarity due to the sulfonamide group, which can engage in hydrogen bonding. Additionally, the bulky tert-butyl and dimethyl groups may influence its steric hindrance and reactivity. Overall, this compound's unique structural features suggest potential utility in synthetic chemistry and possibly in medicinal chemistry, although specific applications would depend on further research and characterization.

Formula: C₁₂H₂₅N₃O₂SSi

InChI: InChI=1S/C12H25N3O2SSi/c1-10-9-13-11(19(7,8)12(2,3)4)15(10)18(16,17)14(5)6/h9H,1-8H3

InChI key: InChIKey=DXVOUIJKRDFEBW-UHFFFAOYSA-N

SMILES: [Si](C(C)(C)C)(C)(C)C=1N(S(N(C)C)(=O)=O)C(C)=CN1

Synonyms:

• 2-[(1,1-Dimethylethyl)dimethylsilyl]-N,N,5-trimethyl-1H-imidazole-1-sulfonamide
• 2-[tert-Butyl(dimethyl)silyl]-N,N,5-trimethylimidazole-1-sulfonamide
• 1H-Imidazole-1-sulfonamide, 2-[(1,1-dimethylethyl)dimethylsilyl]-N,N,5-trimethyl-

2-[(1,1-Dimethylethyl)dimethylsilyl]-N,N,5-trimethyl-1H-imidazole-1-sulfonamide-d3

Controlled Product

CAS: 129378-56-9

Formula: C₁₂H₂₂D₃N₃O₂SSi

Color and Shape: Neat

Molecular weight: 306.51

Ref: TR-D473357