CAS 129392-87-6
:6-AZIDO-N-BOC-HEXYLAMINE
Description:
6-Azido-N-Boc-hexylamine is a chemical compound characterized by the presence of an azido group (-N3) and a tert-butyloxycarbonyl (Boc) protecting group attached to a hexylamine backbone. The azido group is known for its reactivity, particularly in click chemistry applications, allowing for the formation of various derivatives through azide-alkyne cycloaddition reactions. The Boc group serves as a protective moiety for the amine, facilitating the selective functionalization of the amine group without interference from its nucleophilicity. This compound is typically used in organic synthesis and medicinal chemistry, where it can act as an intermediate in the preparation of more complex molecules. Its stability under standard laboratory conditions makes it a valuable reagent, although care must be taken due to the potential hazards associated with azides, which can be explosive under certain conditions. Overall, 6-Azido-N-Boc-hexylamine is a versatile compound in synthetic organic chemistry, particularly in the development of bioactive molecules and materials.
Formula:C11H22N4O2
InChI:InChI=1/C11H22N4O2/c1-11(2,3)17-10(16)13-8-6-4-5-7-9-14-15-12/h4-9H2,1-3H3,(H,13,16)
SMILES:CC(C)(C)OC(=NCCCCCCN=[N+]=[NH-])O
Synonyms:- (6-Azido-hexyl)-carbamic acid tert-butyl ester
- tert-butyl N-(6-azidohexyl)carbamate
- N-Boc-6-azidohexan-1-amine
- tert-Butyl(6-azidohexyl)carbamate
- 6-Azido-N-Boc-hexylamine, CAS 129392-87-6
- N-(6-azidohexyl)carbamic acid tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl(6-azidohexyl)carbamate
CAS:tert-Butyl(6-azidohexyl)carbamateFormula:C11H22N4O2Purity:98%Molecular weight:242.326-Azido-N-Boc-hexylamine
CAS:Formula:C11H22N4O2Purity:98%Color and Shape:LiquidMolecular weight:242.31806-Azido-N-Boc-hexylamine
CAS:Formula:C11H22N4O2Purity:98%Color and Shape:LiquidMolecular weight:242.3236-Azido-N-Boc-hexylamine
CAS:6-Azido-N-Boc-hexylamine is a linker that can be used to attach dextrans, biotin, or other molecules to azides. It is a fluorophore that can be used in the nmr spectra of diameters to measure the size of polymers and can also be used with terminal alkynes for ion exchange chromatography. 6-Azido-N-Boc-hexylamine has been shown to have anticancer activity by inhibiting cell proliferation and inducing apoptosis in carcinoma cells. 6-Azido-N-Boc-hexylamine has functional groups that allow it to react with lipases and function as an enzyme inhibitor.Formula:C11H22N4O2Purity:Min. 95%Molecular weight:242.32 g/mol



