CAS 1293929-87-9

2,4,5,7-Tetrahydropyrano[3,4-c]pyrazole

Description:

2,4,5,7-Tetrahydropyrano[3,4-c]pyrazole is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyran and a pyrazole ring. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups, which can influence its reactivity and interactions with other substances. It is generally soluble in polar organic solvents, and its stability can vary depending on environmental conditions such as temperature and pH. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features can lead to potential applications in various fields, including pharmaceuticals and agrochemicals. As with many heterocycles, the presence of nitrogen atoms in the pyrazole ring can contribute to its ability to form hydrogen bonds, affecting its interactions in biological systems. Overall, 2,4,5,7-Tetrahydropyrano[3,4-c]pyrazole represents a complex and versatile chemical entity with potential utility in various scientific applications.

Formula: C₆H₈N₂O

InChI: InChI=1S/C6H8N2O/c1-2-9-4-6-5(1)3-7-8-6/h3H,1-2,4H2,(H,7,8)

InChI key: InChIKey=LHNAZHNZJIZRCV-UHFFFAOYSA-N

SMILES: C=12C(=NNC1)COCC2

Synonyms:

• Pyrano[3,4-c]pyrazole, 2,4,5,7-tetrahydro-
• 2,4,5,7-Tetrahydropyrano[3,4-c]pyrazole