CAS 129414-88-6
:KRIBB 3
Description:
KRIBB 3, with the CAS number 129414-88-6, is a chemical compound that has garnered attention in the field of biochemistry and molecular biology. It is primarily recognized as a potent inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth, differentiation, and metabolism. The compound is often studied for its potential therapeutic applications, particularly in cancer research, where dysregulation of kinase activity is a common feature. KRIBB 3 exhibits specific binding affinity to its target kinases, which can lead to the modulation of signaling pathways involved in tumor progression. Additionally, its chemical structure may include functional groups that enhance its solubility and bioavailability, making it a candidate for further pharmacological development. As with many research compounds, the safety profile and potential side effects are important considerations for its use in experimental settings. Overall, KRIBB 3 represents a significant tool for researchers exploring kinase-related mechanisms in disease.
Formula:C19H19NO4
InChI:InChI=1/C19H19NO4/c1-4-12-9-15(17(21)10-18(12)23-3)19-16(11-20-24-19)13-5-7-14(22-2)8-6-13/h5-11,20H,4H2,1-3H3/b19-15-
SMILES:CCC1=C/C(=c/2\c(c[nH]o2)c2ccc(cc2)OC)/C(=O)C=C1OC
Synonyms:- Kribb3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
KRIBB3
CAS:KRIBB3: novel anticancer microtubule inhibitor; halts MDA-MB-231 cell migration/invasion by targeting Hsp27 phosphorylation.Formula:C19H19NO4Color and Shape:SolidMolecular weight:325.36

