CAS 129425-83-8
:6-(5,6-Dimethoxybenzo[b]thien-2-yl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone
Description:
6-(5,6-Dimethoxybenzo[b]thien-2-yl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone, with the CAS number 129425-83-8, is a chemical compound characterized by its complex structure, which includes a pyridazinone core fused with a thienyl moiety and substituted with methoxy groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the dimethoxybenzothienyl group may contribute to its pharmacological properties, possibly influencing its interaction with biological targets. Additionally, the dihydropyridazinone framework suggests potential applications in drug development, particularly in areas related to anti-inflammatory or anti-cancer therapies. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like chromatography. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its practical applications.
Formula:C15H16N2O3S
InChI:InChI=1S/C15H16N2O3S/c1-8-4-14(18)16-17-15(8)13-6-9-5-10(19-2)11(20-3)7-12(9)21-13/h5-8H,4H2,1-3H3,(H,16,18)
InChI key:InChIKey=KIYDKXDCNSPKQQ-UHFFFAOYSA-N
SMILES:CC1C(C2=CC=3C(S2)=CC(OC)=C(OC)C3)=NNC(=O)C1
Synonyms:- 3(2H)-Pyridazinone, 6-(5,6-dimethoxybenzo[b]thien-2-yl)-4,5-dihydro-5-methyl-
- 6-(5,6-Dimethoxybenzo[b]thien-2-yl)-4,5-dihydro-5-methyl-3(2H)-pyridazinone
- Org 9935
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Org 9935
CAS:Org 9935 is a potent, selective PDE3 inhibitor with IC50 of 50 nM.Formula:C15H16N2O3SColor and Shape:SolidMolecular weight:304.36
