CAS 129426-47-7
:L-alanyl-L-valylglycyl-L-isoleucylglycyl-L-alanine
Description:
L-alanyl-L-valylglycyl-L-isoleucylglycyl-L-alanine, with the CAS number 129426-47-7, is a synthetic peptide composed of five amino acids: alanine, valine, glycine, and isoleucine. This compound is characterized by its specific sequence of amino acids, which contributes to its unique properties and potential biological activities. Peptides like this one often exhibit various functions, including roles in signaling, enzyme activity modulation, and potential therapeutic applications. The presence of hydrophobic amino acids, such as valine and isoleucine, suggests that the peptide may have a tendency to adopt specific conformations in aqueous environments, influencing its solubility and interaction with biological membranes. Additionally, the peptide's structure may allow it to participate in intermolecular interactions, which can be crucial for its biological efficacy. While specific data on its pharmacological properties may be limited, peptides of this nature are often studied for their potential in drug development and as research tools in biochemistry and molecular biology.
Formula:C21H38N6O7
InChI:InChI=1/C21H38N6O7/c1-7-11(4)17(20(32)24-8-14(28)25-13(6)21(33)34)26-15(29)9-23-19(31)16(10(2)3)27-18(30)12(5)22/h10-13,16-17H,7-9,22H2,1-6H3,(H,23,31)(H,24,32)(H,25,28)(H,26,29)(H,27,30)(H,33,34)/t11-,12-,13-,16-,17-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](C)C(=O)O)O)O)N=C(CN=C([C@H](C(C)C)N=C([C@H](C)N)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
L-Alanine, L-alanyl-L-valylglycyl-L-isoleucylglycyl- (9CI)
CAS:Formula:C21H38N6O7Molecular weight:486.5624HIV (gp41) Fragment
CAS:HIV (gp41) Fragment H-Ala-Val-Gly-Ile-Gly-Ala-OH is a hydrophobic peptide fragment that is used as an antigen to induce immunity against HIV infection. The sequence of the peptide was obtained by sequencing the human immunodeficiency virus type 1 (HIV). The peptide contains glutamic acid and ornithine, which are necessary for the attachment of gp41 to the target cell surface and for the penetration of the virus into cells. The cyclic peptide induces mononuclear phagocytes to produce antibodies against gp41, which can inhibit infection by HIV.Formula:C21H38N6O7Purity:Min. 95%Molecular weight:486.56 g/mol

