CAS 129443-92-1
:(6E)-7-[4,5-bis(4-fluorophenyl)-2-(1-methylethyl)-1H-imidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid
Description:
The chemical substance known as (6E)-7-[4,5-bis(4-fluorophenyl)-2-(1-methylethyl)-1H-imidazol-1-yl]-3,5-dihydroxyhept-6-enoic acid, with the CAS number 129443-92-1, is characterized by its complex molecular structure, which includes an imidazole ring and multiple functional groups such as hydroxyl (-OH) and carboxylic acid (-COOH) groups. This compound is notable for its potential biological activity, particularly in the context of pharmaceutical applications, where it may exhibit properties such as anti-inflammatory or antimicrobial effects. The presence of fluorinated phenyl groups enhances its lipophilicity, potentially influencing its pharmacokinetics and bioavailability. Additionally, the specific stereochemistry indicated by the (6E) configuration suggests that it may have distinct interactions with biological targets, which could be crucial for its efficacy. Overall, this compound represents a class of bioactive molecules that are of interest in medicinal chemistry and drug development.
Formula:C25H26F2N2O4
InChI:InChI=1/C25H26F2N2O4/c1-15(2)25-28-23(16-3-7-18(26)8-4-16)24(17-5-9-19(27)10-6-17)29(25)12-11-20(30)13-21(31)14-22(32)33/h3-12,15,20-21,30-31H,13-14H2,1-2H3,(H,32,33)/b12-11+
Synonyms:- 3,5-Dihydroxy-7-(4,5-bis(4-fluorophenyl)-2-(1-methylethyl)-1H-imidazol-1-yl)-6-heptenoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
GR-95030X
CAS:GR-95030X is a a novel HMG-CoA reductase inhibitor.Formula:C25H26F2N2O4Color and Shape:SolidMolecular weight:456.48
