CymitQuimica logo

CAS 129446-71-5

:

(4S)-4-BENZYL-L-GLUTAMIC ACID

Description:
(4S)-4-BENZYL-L-GLUTAMIC ACID, with the CAS number 129446-71-5, is a derivative of glutamic acid, an amino acid that plays a crucial role in various biological processes. This compound features a benzyl group attached to the fourth carbon of the glutamic acid backbone, which contributes to its unique properties and potential applications. It is characterized by its chiral nature, specifically the (4S) configuration, indicating that it has a specific spatial arrangement of atoms that can influence its biological activity. The presence of the benzyl group enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological conditions, as glutamic acid is a key neurotransmitter. Additionally, its structural features may allow for modifications that could lead to the synthesis of novel compounds with enhanced efficacy or reduced side effects. Overall, (4S)-4-BENZYL-L-GLUTAMIC ACID represents a significant compound in the study of amino acids and their derivatives in medicinal chemistry.
Formula:C12H15NO4
InChI:InChI=1/C12H15NO4/c13-10(12(16)17)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7,13H2,(H,14,15)(H,16,17)/t9-,10-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C[C@@H](C(=O)O)N)C(=O)O
Synonyms:
  • L-Glutamic acid, 4-(phenylmethyl)-, (4S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.