CymitQuimica logo

CAS 129451-79-2

:

N-Benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-8-bromo-2′-deoxyadenosine

Description:
N-Benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-8-bromo-2′-deoxyadenosine is a synthetic nucleoside derivative that exhibits unique structural and chemical characteristics. This compound features a benzoyl group and a complex bis(4-methoxyphenyl)phenylmethyl moiety, which contribute to its lipophilicity and potential for biological activity. The presence of the 8-bromo substituent on the adenine base enhances its reactivity and may influence its interaction with biological targets, such as enzymes or receptors. As a deoxyadenosine derivative, it retains the core purine structure, which is essential for nucleic acid interactions. This compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of antiviral or anticancer agents, due to its potential to modulate biological pathways. Its solubility, stability, and reactivity can be influenced by the substituents on the aromatic rings and the bromine atom, making it a candidate for further research in drug design and development.
Formula:C38H34BrN5O6
InChI:InChI=1S/C38H34BrN5O6/c1-47-28-17-13-26(14-18-28)38(25-11-7-4-8-12-25,27-15-19-29(48-2)20-16-27)49-22-31-30(45)21-32(50-31)44-35-33(42-37(44)39)34(40-23-41-35)43-36(46)24-9-5-3-6-10-24/h3-20,23,30-32,45H,21-22H2,1-2H3,(H,40,41,43,46)/t30-,31+,32+/m0/s1
InChI key:InChIKey=FFUDCIXZEUGJLO-DCMFLLSESA-N
SMILES:C(OC[C@H]1O[C@H](C[C@@H]1O)N2C=3C(N=C2Br)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6)C7=CC=CC=C7
Synonyms:
  • N-Benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-8-bromo-2′-deoxyadenosine
  • Adenosine, N-benzoyl-5′-O-[bis(4-methoxyphenyl)phenylmethyl]-8-bromo-2′-deoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.