CAS 129477-22-1
:2,5-Dimethyl-3-pyridinecarboxylic acid
Description:
2,5-Dimethyl-3-pyridinecarboxylic acid, also known by its CAS number 129477-22-1, is an organic compound characterized by a pyridine ring substituted with two methyl groups and a carboxylic acid functional group. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The methyl groups contribute to its hydrophobic character, influencing its solubility and reactivity. As a pyridine derivative, it may exhibit basic properties, although the carboxylic acid group can also impart acidic characteristics. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and role as a building block in organic synthesis. Its stability under standard conditions makes it suitable for various applications, although specific reactivity and interaction with other substances would depend on the surrounding chemical environment.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5-3-7(8(10)11)6(2)9-4-5/h3-4H,1-2H3,(H,10,11)
InChI key:InChIKey=RKNLFMITUFIMNR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)N=CC(C)=C1
Synonyms:- 2,5-Dimethyl-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
