CAS 129488-39-7

4-(1,1-Dimethylethyl)-N-(4-hydroxyphenyl)benzamide

Description:

4-(1,1-Dimethylethyl)-N-(4-hydroxyphenyl)benzamide, also known by its CAS number 129488-39-7, is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a bulky tert-butyl group (1,1-dimethylethyl) that contributes to its hydrophobic properties, alongside a hydroxyphenyl group that can participate in hydrogen bonding and may enhance solubility in polar solvents. The presence of the hydroxy group also suggests potential antioxidant properties, making it of interest in various applications, including pharmaceuticals and materials science. The molecular structure indicates that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological activity. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, which may affect its behavior in chemical reactions and its overall bioavailability. Overall, this compound's unique structural features make it a subject of interest in both research and industrial applications.

Formula: C₁₇H₁₉NO₂

InChI: InChI=1S/C17H19NO2/c1-17(2,3)13-6-4-12(5-7-13)16(20)18-14-8-10-15(19)11-9-14/h4-11,19H,1-3H3,(H,18,20)

InChI key: InChIKey=NFTXIJBCWDLMMC-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(O)C=C1)(=O)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 4-(1,1-Dimethylethyl)-N-(4-hydroxyphenyl)benzamide
• Benzamide, 4-(1,1-dimethylethyl)-N-(4-hydroxyphenyl)-